C19H38O3Si — CID 102256180
tert-butyl-[(3S,4R,5S,6S)-6-(2-ethoxyethoxy)-3,5-dimethylhept-1-yn-4-yl]oxy-dimethylsilane (PubChem CID 102256180) has the molecular formula C19H38O3Si and a molecular weight of 342.60 g/mol. Its IUPAC name is tert-butyl-[(3S,4R,5S,6S)-6-(2-ethoxyethoxy)-3,5-dimethylhept-1-yn-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3S,4R,5S,6S)-6-(2-ethoxyethoxy)-3,5-dimethylhept-1-yn-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 102256180 |
| Molecular Formula | C19H38O3Si |
| Molecular Weight | 342.60 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | tert-butyl-[(3S,4R,5S,6S)-6-(2-ethoxyethoxy)-3,5-dimethylhept-1-yn-4-yl]oxy-dimethylsilane |
| SMILES | C#C[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@H](C)OCCOCC |
| InChI | InChI=1S/C19H38O3Si/c1-11-15(3)18(22-23(9,10)19(6,7)8)16(4)17(5)21-14-13-20-12-2/h1,15-18H,12-14H2,2-10H3/t15-,16-,17-,18+/m0/s1 |
| InChIKey | CFBUHVHICRUAPF-XLAORIBOSA-N |
| XLogP | 4.72 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.60 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|