C24H43FO4Si — CID 102256186
(2Z,4E,6E,8S,9R,10S,11S)-9-[tert-butyl(dimethyl)silyl]oxy-11-(2-ethoxyethoxy)-2-fluoro-8,10-dimethyldodeca-2,4,6-trienal (PubChem CID 102256186) has the molecular formula C24H43FO4Si and a molecular weight of 442.69 g/mol. Its IUPAC name is (2Z,4E,6E,8S,9R,10S,11S)-9-[tert-butyl(dimethyl)silyl]oxy-11-(2-ethoxyethoxy)-2-fluoro-8,10-dimethyldodeca-2,4,6-trienal.
| Compound Name | (2Z,4E,6E,8S,9R,10S,11S)-9-[tert-butyl(dimethyl)silyl]oxy-11-(2-ethoxyethoxy)-2-fluoro-8,10-dimethyldodeca-2,4,6-trienal |
|---|---|
| PubChem CID | 102256186 |
| Molecular Formula | C24H43FO4Si |
| Molecular Weight | 442.69 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | (2Z,4E,6E,8S,9R,10S,11S)-9-[tert-butyl(dimethyl)silyl]oxy-11-(2-ethoxyethoxy)-2-fluoro-8,10-dimethyldodeca-2,4,6-trienal |
| SMILES | CCOCCO[C@@H](C)[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C/C=C/C=C(\F)C=O |
| InChI | InChI=1S/C24H43FO4Si/c1-10-27-16-17-28-21(4)20(3)23(29-30(8,9)24(5,6)7)19(2)14-12-11-13-15-22(25)18-26/h11-15,18-21,23H,10,16-17H2,1-9H3/b13-11+,14-12+,22-15-/t19-,20-,21-,23+/m0/s1 |
| InChIKey | QTMQDLKCYMBFKR-ASQLYOPOSA-N |
| XLogP | 6.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.69 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|