C18H28N2O6 — CID 102256223
1-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)-3-propylurea (PubChem CID 102256223) has the molecular formula C18H28N2O6 and a molecular weight of 368.43 g/mol. Its IUPAC name is 1-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)-3-propylurea.
| Compound Name | 1-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)-3-propylurea |
|---|---|
| PubChem CID | 102256223 |
| Molecular Formula | C18H28N2O6 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 1-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)-3-propylurea |
| SMILES | CCCNC(=O)Nc1ccc2c(c1)OCCOCCOCCOCCO2 |
| InChI | InChI=1S/C18H28N2O6/c1-2-5-19-18(21)20-15-3-4-16-17(14-15)26-13-11-24-9-7-22-6-8-23-10-12-25-16/h3-4,14H,2,5-13H2,1H3,(H2,19,20,21) |
| InChIKey | QOUBEWYINGOWIH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |