About (1-oxo-3,4-dihydro-2H-isoquinolin-3-yl)methyl acetate
(1-oxo-3,4-dihydro-2H-isoquinolin-3-yl)methyl acetate (PubChem CID 102256505) has the molecular formula C12H13NO3
and a molecular weight of 219.24 g/mol. Its IUPAC name is (1-oxo-3,4-dihydro-2H-isoquinolin-3-yl)methyl acetate.
Molecular Properties
| Compound Name | (1-oxo-3,4-dihydro-2H-isoquinolin-3-yl)methyl acetate |
| PubChem CID | 102256505 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | (1-oxo-3,4-dihydro-2H-isoquinolin-3-yl)methyl acetate |
| SMILES | CC(=O)OCC1Cc2ccccc2C(=O)N1 |
| InChI | InChI=1S/C12H13NO3/c1-8(14)16-7-10-6-9-4-2-3-5-11(9)12(15)13-10/h2-5,10H,6-7H2,1H3,(H,13,15) |
| InChIKey | RSUYRIFEWQQHHE-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-oxo-3,4-dihydro-2H-isoquinolin-3-yl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-oxo-3,4-dihydro-2H-isoquinolin-3-yl)methyl acetate?
The IUPAC name of (1-oxo-3,4-dihydro-2H-isoquinolin-3-yl)methyl acetate (CID 102256505) is (1-oxo-3,4-dihydro-2H-isoquinolin-3-yl)methyl acetate.
What is the SMILES notation for (1-oxo-3,4-dihydro-2H-isoquinolin-3-yl)methyl acetate?
The canonical SMILES for (1-oxo-3,4-dihydro-2H-isoquinolin-3-yl)methyl acetate is CC(=O)OCC1Cc2ccccc2C(=O)N1.
What is the InChIKey of (1-oxo-3,4-dihydro-2H-isoquinolin-3-yl)methyl acetate?
The InChIKey is RSUYRIFEWQQHHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO3/c1-8(14)16-7-10-6-9-4-2-3-5-11(9)12(15)13-10/h2-5,10H,6-7H2,1H3,(H,13,15).
What are the key properties of (1-oxo-3,4-dihydro-2H-isoquinolin-3-yl)methyl acetate?
(1-oxo-3,4-dihydro-2H-isoquinolin-3-yl)methyl acetate has a molecular weight of 219.24 g/mol, XLogP of 0.90, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-oxo-3,4-dihydro-2H-isoquinolin-3-yl)methyl acetate is sourced from PubChem (CID 102256505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).