C39H44O8 — CID 102257040
methyl (2S)-2-hydroxy-4-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanoate (PubChem CID 102257040) has the molecular formula C39H44O8 and a molecular weight of 640.77 g/mol. Its IUPAC name is methyl (2S)-2-hydroxy-4-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanoate.
| Compound Name | methyl (2S)-2-hydroxy-4-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanoate |
|---|---|
| PubChem CID | 102257040 |
| Molecular Formula | C39H44O8 |
| Molecular Weight | 640.77 g/mol |
| Exact Mass | 640.30 |
| IUPAC Name | methyl (2S)-2-hydroxy-4-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanoate |
| SMILES | COC(=O)[C@@H](O)CC[C@@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C39H44O8/c1-42-39(41)33(40)22-23-34-36(44-25-30-16-8-3-9-17-30)38(46-27-32-20-12-5-13-21-32)37(45-26-31-18-10-4-11-19-31)35(47-34)28-43-24-29-14-6-2-7-15-29/h2-21,33-38,40H,22-28H2,1H3/t33-,34-,35+,36-,37-,38+/m0/s1 |
| InChIKey | BTWWFPLQIZFSKC-OHKUXPBOSA-N |
| XLogP | 6.04 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.77 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |