C33H34N2O — CID 102257104
(3R,4R)-1,3-dibenzyl-4-[benzyl-[(1S)-1-phenylethyl]amino]pyrrolidin-2-one (PubChem CID 102257104) has the molecular formula C33H34N2O and a molecular weight of 474.65 g/mol. Its IUPAC name is (3R,4R)-1,3-dibenzyl-4-[benzyl-[(1S)-1-phenylethyl]amino]pyrrolidin-2-one.
| Compound Name | (3R,4R)-1,3-dibenzyl-4-[benzyl-[(1S)-1-phenylethyl]amino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 102257104 |
| Molecular Formula | C33H34N2O |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | (3R,4R)-1,3-dibenzyl-4-[benzyl-[(1S)-1-phenylethyl]amino]pyrrolidin-2-one |
| SMILES | C[C@@H](c1ccccc1)N(Cc1ccccc1)[C@H]1CN(Cc2ccccc2)C(=O)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C33H34N2O/c1-26(30-20-12-5-13-21-30)35(24-29-18-10-4-11-19-29)32-25-34(23-28-16-8-3-9-17-28)33(36)31(32)22-27-14-6-2-7-15-27/h2-21,26,31-32H,22-25H2,1H3/t26-,31+,32-/m0/s1 |
| InChIKey | LFSKYPKNZQYGIC-YKTXNGGMSA-N |
| XLogP | 6.52 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |