About 2-prop-1-en-2-yl-3,4-dihydroquinolizin-5-ium
2-prop-1-en-2-yl-3,4-dihydroquinolizin-5-ium (PubChem CID 102257145) has the molecular formula C12H14N+
and a molecular weight of 172.25 g/mol. Its IUPAC name is 2-prop-1-en-2-yl-3,4-dihydroquinolizin-5-ium.
Molecular Properties
| Compound Name | 2-prop-1-en-2-yl-3,4-dihydroquinolizin-5-ium |
| PubChem CID | 102257145 |
| Molecular Formula | C12H14N+ |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 2-prop-1-en-2-yl-3,4-dihydroquinolizin-5-ium |
| SMILES | C=C(C)C1=Cc2cccc[n+]2CC1 |
| InChI | InChI=1S/C12H14N/c1-10(2)11-6-8-13-7-4-3-5-12(13)9-11/h3-5,7,9H,1,6,8H2,2H3/q+1 |
| InChIKey | GCJFXCADMDHHSQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-1-en-2-yl-3,4-dihydroquinolizin-5-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-1-en-2-yl-3,4-dihydroquinolizin-5-ium?
The IUPAC name of 2-prop-1-en-2-yl-3,4-dihydroquinolizin-5-ium (CID 102257145) is 2-prop-1-en-2-yl-3,4-dihydroquinolizin-5-ium.
What is the SMILES notation for 2-prop-1-en-2-yl-3,4-dihydroquinolizin-5-ium?
The canonical SMILES for 2-prop-1-en-2-yl-3,4-dihydroquinolizin-5-ium is C=C(C)C1=Cc2cccc[n+]2CC1.
What is the InChIKey of 2-prop-1-en-2-yl-3,4-dihydroquinolizin-5-ium?
The InChIKey is GCJFXCADMDHHSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N/c1-10(2)11-6-8-13-7-4-3-5-12(13)9-11/h3-5,7,9H,1,6,8H2,2H3/q+1.
What are the key properties of 2-prop-1-en-2-yl-3,4-dihydroquinolizin-5-ium?
2-prop-1-en-2-yl-3,4-dihydroquinolizin-5-ium has a molecular weight of 172.25 g/mol, XLogP of 2.34, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-1-en-2-yl-3,4-dihydroquinolizin-5-ium is sourced from PubChem (CID 102257145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).