C20H18F6N2OS — CID 10225721
(4R)-4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-1-methyl-4-phenylimidazolidine-2-thione (PubChem CID 10225721) has the molecular formula C20H18F6N2OS and a molecular weight of 448.43 g/mol. Its IUPAC name is (4R)-4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-1-methyl-4-phenylimidazolidine-2-thione.
| Compound Name | (4R)-4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-1-methyl-4-phenylimidazolidine-2-thione |
|---|---|
| PubChem CID | 10225721 |
| Molecular Formula | C20H18F6N2OS |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | (4R)-4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-1-methyl-4-phenylimidazolidine-2-thione |
| SMILES | CN1C[C@@](COCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2ccccc2)NC1=S |
| InChI | InChI=1S/C20H18F6N2OS/c1-28-11-18(27-17(28)30,14-5-3-2-4-6-14)12-29-10-13-7-15(19(21,22)23)9-16(8-13)20(24,25)26/h2-9H,10-12H2,1H3,(H,27,30)/t18-/m1/s1 |
| InChIKey | UOTWSTNRPXKSOR-GOSISDBHSA-N |
| XLogP | 4.96 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|