About [(E)-2-cyclohexylethenyl]-pentafluoro-λ6-sulfane
[(E)-2-cyclohexylethenyl]-pentafluoro-λ6-sulfane (PubChem CID 102257368) has the molecular formula C8H13F5S
and a molecular weight of 236.25 g/mol. Its IUPAC name is [(E)-2-cyclohexylethenyl]-pentafluoro-λ6-sulfane.
Molecular Properties
| Compound Name | [(E)-2-cyclohexylethenyl]-pentafluoro-λ6-sulfane |
|---|
| PubChem CID | 102257368 |
|---|
| Molecular Formula | C8H13F5S |
|---|
| Molecular Weight | 236.25 g/mol |
|---|
| Exact Mass | 236.07 |
|---|
| IUPAC Name | [(E)-2-cyclohexylethenyl]-pentafluoro-λ6-sulfane |
|---|
| SMILES | FS(F)(F)(F)(F)/C=C/C1CCCCC1 |
|---|
| InChI | InChI=1S/C8H13F5S/c9-14(10,11,12,13)7-6-8-4-2-1-3-5-8/h6-8H,1-5H2/b7-6+ |
|---|
| InChIKey | WOSNRUYTMAMXLC-VOTSOKGWSA-N |
|---|
| XLogP | 5.38 |
|---|
| TPSA | 0.00 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | |
|---|
| Rotatable Bonds | 2 |
|---|
| Heavy Atoms | 14 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
1 violation
| Rule | Value |
|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze [(E)-2-cyclohexylethenyl]-pentafluoro-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-2-cyclohexylethenyl]-pentafluoro-λ6-sulfane?
The IUPAC name of [(E)-2-cyclohexylethenyl]-pentafluoro-λ6-sulfane (CID 102257368) is [(E)-2-cyclohexylethenyl]-pentafluoro-λ6-sulfane.
What is the SMILES notation for [(E)-2-cyclohexylethenyl]-pentafluoro-λ6-sulfane?
The canonical SMILES for [(E)-2-cyclohexylethenyl]-pentafluoro-λ6-sulfane is FS(F)(F)(F)(F)/C=C/C1CCCCC1.
What is the InChIKey of [(E)-2-cyclohexylethenyl]-pentafluoro-λ6-sulfane?
The InChIKey is WOSNRUYTMAMXLC-VOTSOKGWSA-N. The full InChI is InChI=1S/C8H13F5S/c9-14(10,11,12,13)7-6-8-4-2-1-3-5-8/h6-8H,1-5H2/b7-6+.
What are the key properties of [(E)-2-cyclohexylethenyl]-pentafluoro-λ6-sulfane?
[(E)-2-cyclohexylethenyl]-pentafluoro-λ6-sulfane has a molecular weight of 236.25 g/mol, XLogP of 5.38, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-2-cyclohexylethenyl]-pentafluoro-λ6-sulfane is sourced from PubChem (CID 102257368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).