C27H38O8 — CID 102257939
5-[(E)-6-(2,2-dimethyl-4,6-dioxo-5-prop-2-enyl-1,3-dioxan-5-yl)hex-4-enyl]-5-[(E)-hex-2-enyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 102257939) has the molecular formula C27H38O8 and a molecular weight of 490.59 g/mol. Its IUPAC name is 5-[(E)-6-(2,2-dimethyl-4,6-dioxo-5-prop-2-enyl-1,3-dioxan-5-yl)hex-4-enyl]-5-[(E)-hex-2-enyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(E)-6-(2,2-dimethyl-4,6-dioxo-5-prop-2-enyl-1,3-dioxan-5-yl)hex-4-enyl]-5-[(E)-hex-2-enyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 102257939 |
| Molecular Formula | C27H38O8 |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | 5-[(E)-6-(2,2-dimethyl-4,6-dioxo-5-prop-2-enyl-1,3-dioxan-5-yl)hex-4-enyl]-5-[(E)-hex-2-enyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | C=CCC1(C/C=C/CCCC2(C/C=C/CCC)C(=O)OC(C)(C)OC2=O)C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C27H38O8/c1-7-9-10-13-18-27(22(30)34-25(5,6)35-23(27)31)19-15-12-11-14-17-26(16-8-2)20(28)32-24(3,4)33-21(26)29/h8,10-11,13-14H,2,7,9,12,15-19H2,1,3-6H3/b13-10+,14-11+ |
| InChIKey | SIUPPIZAIBXTAL-IFQMDVHZSA-N |
| XLogP | 5.07 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|