About 2-(cyclohexylamino)-6,6-dimethyl-4-oxo-5,7-dihydro-1-benzofuran-3-carbaldehyde
2-(cyclohexylamino)-6,6-dimethyl-4-oxo-5,7-dihydro-1-benzofuran-3-carbaldehyde (PubChem CID 102258073) has the molecular formula C17H23NO3
and a molecular weight of 289.37 g/mol. Its IUPAC name is 2-(cyclohexylamino)-6,6-dimethyl-4-oxo-5,7-dihydro-1-benzofuran-3-carbaldehyde.
Molecular Properties
| Compound Name | 2-(cyclohexylamino)-6,6-dimethyl-4-oxo-5,7-dihydro-1-benzofuran-3-carbaldehyde |
| PubChem CID | 102258073 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 2-(cyclohexylamino)-6,6-dimethyl-4-oxo-5,7-dihydro-1-benzofuran-3-carbaldehyde |
| SMILES | CC1(C)CC(=O)c2c(oc(NC3CCCCC3)c2C=O)C1 |
| InChI | InChI=1S/C17H23NO3/c1-17(2)8-13(20)15-12(10-19)16(21-14(15)9-17)18-11-6-4-3-5-7-11/h10-11,18H,3-9H2,1-2H3 |
| InChIKey | LAYLPEQPAYIKMD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(cyclohexylamino)-6,6-dimethyl-4-oxo-5,7-dihydro-1-benzofuran-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclohexylamino)-6,6-dimethyl-4-oxo-5,7-dihydro-1-benzofuran-3-carbaldehyde?
The IUPAC name of 2-(cyclohexylamino)-6,6-dimethyl-4-oxo-5,7-dihydro-1-benzofuran-3-carbaldehyde (CID 102258073) is 2-(cyclohexylamino)-6,6-dimethyl-4-oxo-5,7-dihydro-1-benzofuran-3-carbaldehyde.
What is the SMILES notation for 2-(cyclohexylamino)-6,6-dimethyl-4-oxo-5,7-dihydro-1-benzofuran-3-carbaldehyde?
The canonical SMILES for 2-(cyclohexylamino)-6,6-dimethyl-4-oxo-5,7-dihydro-1-benzofuran-3-carbaldehyde is CC1(C)CC(=O)c2c(oc(NC3CCCCC3)c2C=O)C1.
What is the InChIKey of 2-(cyclohexylamino)-6,6-dimethyl-4-oxo-5,7-dihydro-1-benzofuran-3-carbaldehyde?
The InChIKey is LAYLPEQPAYIKMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO3/c1-17(2)8-13(20)15-12(10-19)16(21-14(15)9-17)18-11-6-4-3-5-7-11/h10-11,18H,3-9H2,1-2H3.
What are the key properties of 2-(cyclohexylamino)-6,6-dimethyl-4-oxo-5,7-dihydro-1-benzofuran-3-carbaldehyde?
2-(cyclohexylamino)-6,6-dimethyl-4-oxo-5,7-dihydro-1-benzofuran-3-carbaldehyde has a molecular weight of 289.37 g/mol, XLogP of 3.99, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexylamino)-6,6-dimethyl-4-oxo-5,7-dihydro-1-benzofuran-3-carbaldehyde is sourced from PubChem (CID 102258073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).