C29H28O — CID 102258442
(1S,2S,4E)-4-benzylidene-2-(4-methoxyphenyl)-1-phenyl-1,2,5,6,7,7a-hexahydroindene (PubChem CID 102258442) has the molecular formula C29H28O and a molecular weight of 392.54 g/mol. Its IUPAC name is (1S,2S,4E)-4-benzylidene-2-(4-methoxyphenyl)-1-phenyl-1,2,5,6,7,7a-hexahydroindene.
| Compound Name | (1S,2S,4E)-4-benzylidene-2-(4-methoxyphenyl)-1-phenyl-1,2,5,6,7,7a-hexahydroindene |
|---|---|
| PubChem CID | 102258442 |
| Molecular Formula | C29H28O |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | (1S,2S,4E)-4-benzylidene-2-(4-methoxyphenyl)-1-phenyl-1,2,5,6,7,7a-hexahydroindene |
| SMILES | COc1ccc([C@H]2C=C3/C(=C/c4ccccc4)CCCC3[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C29H28O/c1-30-25-17-15-22(16-18-25)28-20-27-24(19-21-9-4-2-5-10-21)13-8-14-26(27)29(28)23-11-6-3-7-12-23/h2-7,9-12,15-20,26,28-29H,8,13-14H2,1H3/b24-19+/t26?,28-,29+/m1/s1 |
| InChIKey | JXBDHMWCHPTARK-SPBIQMPKSA-N |
| XLogP | 7.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |