About 6,11-dioxotetracene-5,12-diolate
6,11-dioxotetracene-5,12-diolate (PubChem CID 102258482) has the molecular formula C18H8O4-2
and a molecular weight of 288.26 g/mol. Its IUPAC name is 6,11-dioxotetracene-5,12-diolate.
Molecular Properties
| Compound Name | 6,11-dioxotetracene-5,12-diolate |
| PubChem CID | 102258482 |
| Molecular Formula | C18H8O4-2 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 6,11-dioxotetracene-5,12-diolate |
| SMILES | O=C1c2ccccc2C(=O)c2c1c([O-])c1ccccc1c2[O-] |
| InChI | InChI=1S/C18H10O4/c19-15-9-5-1-2-6-10(9)16(20)14-13(15)17(21)11-7-3-4-8-12(11)18(14)22/h1-8,19-20H/p-2 |
| InChIKey | QECAURYYBPUIFF-UHFFFAOYSA-L |
| XLogP | 1.76 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 6,11-dioxotetracene-5,12-diolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,11-dioxotetracene-5,12-diolate?
The IUPAC name of 6,11-dioxotetracene-5,12-diolate (CID 102258482) is 6,11-dioxotetracene-5,12-diolate.
What is the SMILES notation for 6,11-dioxotetracene-5,12-diolate?
The canonical SMILES for 6,11-dioxotetracene-5,12-diolate is O=C1c2ccccc2C(=O)c2c1c([O-])c1ccccc1c2[O-].
What is the InChIKey of 6,11-dioxotetracene-5,12-diolate?
The InChIKey is QECAURYYBPUIFF-UHFFFAOYSA-L. The full InChI is InChI=1S/C18H10O4/c19-15-9-5-1-2-6-10(9)16(20)14-13(15)17(21)11-7-3-4-8-12(11)18(14)22/h1-8,19-20H/p-2.
What are the key properties of 6,11-dioxotetracene-5,12-diolate?
6,11-dioxotetracene-5,12-diolate has a molecular weight of 288.26 g/mol, XLogP of 1.76, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,11-dioxotetracene-5,12-diolate is sourced from PubChem (CID 102258482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).