About [(2R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutan-2-yl] acetate
[(2R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutan-2-yl] acetate (PubChem CID 102258710) has the molecular formula C17H25NO4
and a molecular weight of 307.39 g/mol. Its IUPAC name is [(2R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutan-2-yl] acetate.
Molecular Properties
| Compound Name | [(2R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutan-2-yl] acetate |
| PubChem CID | 102258710 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | [(2R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutan-2-yl] acetate |
| SMILES | CC(=O)O[C@H](C)C[C@H](NC(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C17H25NO4/c1-12(21-13(2)19)11-15(14-9-7-6-8-10-14)18-16(20)22-17(3,4)5/h6-10,12,15H,11H2,1-5H3,(H,18,20)/t12-,15+/m1/s1 |
| InChIKey | NIORGVJPPHUAIL-DOMZBBRYSA-N |
| XLogP | 3.59 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutan-2-yl] acetate?
The IUPAC name of [(2R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutan-2-yl] acetate (CID 102258710) is [(2R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutan-2-yl] acetate.
What is the SMILES notation for [(2R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutan-2-yl] acetate?
The canonical SMILES for [(2R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutan-2-yl] acetate is CC(=O)O[C@H](C)C[C@H](NC(=O)OC(C)(C)C)c1ccccc1.
What is the InChIKey of [(2R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutan-2-yl] acetate?
The InChIKey is NIORGVJPPHUAIL-DOMZBBRYSA-N. The full InChI is InChI=1S/C17H25NO4/c1-12(21-13(2)19)11-15(14-9-7-6-8-10-14)18-16(20)22-17(3,4)5/h6-10,12,15H,11H2,1-5H3,(H,18,20)/t12-,15+/m1/s1.
What are the key properties of [(2R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutan-2-yl] acetate?
[(2R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutan-2-yl] acetate has a molecular weight of 307.39 g/mol, XLogP of 3.59, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutan-2-yl] acetate is sourced from PubChem (CID 102258710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).