C18H18ClN3O5S — CID 102258795
(4R,5S)-5'-chloro-4-(4,4-dimethyl-2-oxo-1,3-oxazolidine-3-carbonyl)-1',7'-dimethyl-2-sulfanylidenespiro[1,3-oxazolidine-5,3'-indole]-2'-one (PubChem CID 102258795) has the molecular formula C18H18ClN3O5S and a molecular weight of 423.88 g/mol. Its IUPAC name is (4R,5S)-5'-chloro-4-(4,4-dimethyl-2-oxo-1,3-oxazolidine-3-carbonyl)-1',7'-dimethyl-2-sulfanylidenespiro[1,3-oxazolidine-5,3'-indole]-2'-one.
| Compound Name | (4R,5S)-5'-chloro-4-(4,4-dimethyl-2-oxo-1,3-oxazolidine-3-carbonyl)-1',7'-dimethyl-2-sulfanylidenespiro[1,3-oxazolidine-5,3'-indole]-2'-one |
|---|---|
| PubChem CID | 102258795 |
| Molecular Formula | C18H18ClN3O5S |
| Molecular Weight | 423.88 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | (4R,5S)-5'-chloro-4-(4,4-dimethyl-2-oxo-1,3-oxazolidine-3-carbonyl)-1',7'-dimethyl-2-sulfanylidenespiro[1,3-oxazolidine-5,3'-indole]-2'-one |
| SMILES | Cc1cc(Cl)cc2c1N(C)C(=O)[C@]21OC(=S)N[C@H]1C(=O)N1C(=O)OCC1(C)C |
| InChI | InChI=1S/C18H18ClN3O5S/c1-8-5-9(19)6-10-11(8)21(4)14(24)18(10)12(20-15(28)27-18)13(23)22-16(25)26-7-17(22,2)3/h5-6,12H,7H2,1-4H3,(H,20,28)/t12-,18-/m0/s1 |
| InChIKey | DCILMAOLVQUHRE-SGTLLEGYSA-N |
| XLogP | 1.85 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.88 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|