C19H19N3O5S — CID 102258798
(4R,5S)-4-(4,4-dimethyl-2-oxo-1,3-oxazolidine-3-carbonyl)-1'-prop-2-enyl-2-sulfanylidenespiro[1,3-oxazolidine-5,3'-indole]-2'-one (PubChem CID 102258798) has the molecular formula C19H19N3O5S and a molecular weight of 401.44 g/mol. Its IUPAC name is (4R,5S)-4-(4,4-dimethyl-2-oxo-1,3-oxazolidine-3-carbonyl)-1'-prop-2-enyl-2-sulfanylidenespiro[1,3-oxazolidine-5,3'-indole]-2'-one.
| Compound Name | (4R,5S)-4-(4,4-dimethyl-2-oxo-1,3-oxazolidine-3-carbonyl)-1'-prop-2-enyl-2-sulfanylidenespiro[1,3-oxazolidine-5,3'-indole]-2'-one |
|---|---|
| PubChem CID | 102258798 |
| Molecular Formula | C19H19N3O5S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | (4R,5S)-4-(4,4-dimethyl-2-oxo-1,3-oxazolidine-3-carbonyl)-1'-prop-2-enyl-2-sulfanylidenespiro[1,3-oxazolidine-5,3'-indole]-2'-one |
| SMILES | C=CCN1C(=O)[C@]2(OC(=S)N[C@H]2C(=O)N2C(=O)OCC2(C)C)c2ccccc21 |
| InChI | InChI=1S/C19H19N3O5S/c1-4-9-21-12-8-6-5-7-11(12)19(15(21)24)13(20-16(28)27-19)14(23)22-17(25)26-10-18(22,2)3/h4-8,13H,1,9-10H2,2-3H3,(H,20,28)/t13-,19-/m0/s1 |
| InChIKey | UGIJBCFPGRSMJP-DJJJIMSYSA-N |
| XLogP | 1.45 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|