About [2-pyridin-3-yl-4-(trifluoromethyl)-5H-1,3-thiazol-4-yl] 4-ethoxybenzoate
[2-pyridin-3-yl-4-(trifluoromethyl)-5H-1,3-thiazol-4-yl] 4-ethoxybenzoate (PubChem CID 102258895) has the molecular formula C18H15F3N2O3S
and a molecular weight of 396.39 g/mol. Its IUPAC name is [2-pyridin-3-yl-4-(trifluoromethyl)-5H-1,3-thiazol-4-yl] 4-ethoxybenzoate.
Molecular Properties
| Compound Name | [2-pyridin-3-yl-4-(trifluoromethyl)-5H-1,3-thiazol-4-yl] 4-ethoxybenzoate |
| PubChem CID | 102258895 |
| Molecular Formula | C18H15F3N2O3S |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | [2-pyridin-3-yl-4-(trifluoromethyl)-5H-1,3-thiazol-4-yl] 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OC2(C(F)(F)F)CSC(c3cccnc3)=N2)cc1 |
| InChI | InChI=1S/C18H15F3N2O3S/c1-2-25-14-7-5-12(6-8-14)16(24)26-17(18(19,20)21)11-27-15(23-17)13-4-3-9-22-10-13/h3-10H,2,11H2,1H3 |
| InChIKey | ZWGBSVQUCXEKFO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 60.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-pyridin-3-yl-4-(trifluoromethyl)-5H-1,3-thiazol-4-yl] 4-ethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-pyridin-3-yl-4-(trifluoromethyl)-5H-1,3-thiazol-4-yl] 4-ethoxybenzoate?
The IUPAC name of [2-pyridin-3-yl-4-(trifluoromethyl)-5H-1,3-thiazol-4-yl] 4-ethoxybenzoate (CID 102258895) is [2-pyridin-3-yl-4-(trifluoromethyl)-5H-1,3-thiazol-4-yl] 4-ethoxybenzoate.
What is the SMILES notation for [2-pyridin-3-yl-4-(trifluoromethyl)-5H-1,3-thiazol-4-yl] 4-ethoxybenzoate?
The canonical SMILES for [2-pyridin-3-yl-4-(trifluoromethyl)-5H-1,3-thiazol-4-yl] 4-ethoxybenzoate is CCOc1ccc(C(=O)OC2(C(F)(F)F)CSC(c3cccnc3)=N2)cc1.
What is the InChIKey of [2-pyridin-3-yl-4-(trifluoromethyl)-5H-1,3-thiazol-4-yl] 4-ethoxybenzoate?
The InChIKey is ZWGBSVQUCXEKFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15F3N2O3S/c1-2-25-14-7-5-12(6-8-14)16(24)26-17(18(19,20)21)11-27-15(23-17)13-4-3-9-22-10-13/h3-10H,2,11H2,1H3.
What are the key properties of [2-pyridin-3-yl-4-(trifluoromethyl)-5H-1,3-thiazol-4-yl] 4-ethoxybenzoate?
[2-pyridin-3-yl-4-(trifluoromethyl)-5H-1,3-thiazol-4-yl] 4-ethoxybenzoate has a molecular weight of 396.39 g/mol, XLogP of 4.09, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-pyridin-3-yl-4-(trifluoromethyl)-5H-1,3-thiazol-4-yl] 4-ethoxybenzoate is sourced from PubChem (CID 102258895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).