About ethyl 2-(2,4-dioxo-1H-pyrimidin-5-yl)-2,2-difluoroacetate
ethyl 2-(2,4-dioxo-1H-pyrimidin-5-yl)-2,2-difluoroacetate (PubChem CID 102258946) has the molecular formula C8H8F2N2O4
and a molecular weight of 234.16 g/mol. Its IUPAC name is ethyl 2-(2,4-dioxo-1H-pyrimidin-5-yl)-2,2-difluoroacetate.
Molecular Properties
| Compound Name | ethyl 2-(2,4-dioxo-1H-pyrimidin-5-yl)-2,2-difluoroacetate |
| PubChem CID | 102258946 |
| Molecular Formula | C8H8F2N2O4 |
| Molecular Weight | 234.16 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | ethyl 2-(2,4-dioxo-1H-pyrimidin-5-yl)-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H8F2N2O4/c1-2-16-6(14)8(9,10)4-3-11-7(15)12-5(4)13/h3H,2H2,1H3,(H2,11,12,13,15) |
| InChIKey | PHGFCPWCFXIVNS-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.16 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-(2,4-dioxo-1H-pyrimidin-5-yl)-2,2-difluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(2,4-dioxo-1H-pyrimidin-5-yl)-2,2-difluoroacetate?
The IUPAC name of ethyl 2-(2,4-dioxo-1H-pyrimidin-5-yl)-2,2-difluoroacetate (CID 102258946) is ethyl 2-(2,4-dioxo-1H-pyrimidin-5-yl)-2,2-difluoroacetate.
What is the SMILES notation for ethyl 2-(2,4-dioxo-1H-pyrimidin-5-yl)-2,2-difluoroacetate?
The canonical SMILES for ethyl 2-(2,4-dioxo-1H-pyrimidin-5-yl)-2,2-difluoroacetate is CCOC(=O)C(F)(F)c1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of ethyl 2-(2,4-dioxo-1H-pyrimidin-5-yl)-2,2-difluoroacetate?
The InChIKey is PHGFCPWCFXIVNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F2N2O4/c1-2-16-6(14)8(9,10)4-3-11-7(15)12-5(4)13/h3H,2H2,1H3,(H2,11,12,13,15).
What are the key properties of ethyl 2-(2,4-dioxo-1H-pyrimidin-5-yl)-2,2-difluoroacetate?
ethyl 2-(2,4-dioxo-1H-pyrimidin-5-yl)-2,2-difluoroacetate has a molecular weight of 234.16 g/mol, XLogP of -0.28, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(2,4-dioxo-1H-pyrimidin-5-yl)-2,2-difluoroacetate is sourced from PubChem (CID 102258946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).