C11H10F6O2 — CID 102259080
2,2,3,3,4,4-hexafluoro-5-prop-2-enoxy-5-prop-2-enylcyclopentan-1-one (PubChem CID 102259080) has the molecular formula C11H10F6O2 and a molecular weight of 288.19 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexafluoro-5-prop-2-enoxy-5-prop-2-enylcyclopentan-1-one.
| Compound Name | 2,2,3,3,4,4-hexafluoro-5-prop-2-enoxy-5-prop-2-enylcyclopentan-1-one |
|---|---|
| PubChem CID | 102259080 |
| Molecular Formula | C11H10F6O2 |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 2,2,3,3,4,4-hexafluoro-5-prop-2-enoxy-5-prop-2-enylcyclopentan-1-one |
| SMILES | C=CCOC1(CC=C)C(=O)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11H10F6O2/c1-3-5-8(19-6-4-2)7(18)9(12,13)11(16,17)10(8,14)15/h3-4H,1-2,5-6H2 |
| InChIKey | MVSQBLGRALHRFM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|