C19H29NO8 — CID 102259088
diethyl 2-[[(3aR,4S,7R,7aR)-7-hydroxy-2,2-dimethyl-4-prop-2-enoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-5-yl]methylidene]propanedioate (PubChem CID 102259088) has the molecular formula C19H29NO8 and a molecular weight of 399.44 g/mol. Its IUPAC name is diethyl 2-[[(3aR,4S,7R,7aR)-7-hydroxy-2,2-dimethyl-4-prop-2-enoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-5-yl]methylidene]propanedioate.
| Compound Name | diethyl 2-[[(3aR,4S,7R,7aR)-7-hydroxy-2,2-dimethyl-4-prop-2-enoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-5-yl]methylidene]propanedioate |
|---|---|
| PubChem CID | 102259088 |
| Molecular Formula | C19H29NO8 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | diethyl 2-[[(3aR,4S,7R,7aR)-7-hydroxy-2,2-dimethyl-4-prop-2-enoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-5-yl]methylidene]propanedioate |
| SMILES | C=CCO[C@H]1[C@@H]2OC(C)(C)O[C@@H]2[C@H](O)CN1C=C(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C19H29NO8/c1-6-9-26-16-15-14(27-19(4,5)28-15)13(21)11-20(16)10-12(17(22)24-7-2)18(23)25-8-3/h6,10,13-16,21H,1,7-9,11H2,2-5H3/t13-,14-,15-,16+/m1/s1 |
| InChIKey | CVJWRMJTJBFFBP-FPCVCCKLSA-N |
| XLogP | 0.72 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|