C24H37NO7 — CID 10225933
2-hydroxyethyl N-[[(1S,2R,3S,4S,6R,7S,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl]oxycarbonyl]carbamate (PubChem CID 10225933) has the molecular formula C24H37NO7 and a molecular weight of 451.56 g/mol. Its IUPAC name is 2-hydroxyethyl N-[[(1S,2R,3S,4S,6R,7S,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl]oxycarbonyl]carbamate.
| Compound Name | 2-hydroxyethyl N-[[(1S,2R,3S,4S,6R,7S,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl]oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 10225933 |
| Molecular Formula | C24H37NO7 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | 2-hydroxyethyl N-[[(1S,2R,3S,4S,6R,7S,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl]oxycarbonyl]carbamate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)NC(=O)OCCO)[C@@]2(C)C(C)CC[C@]3(CCC(=O)[C@H]32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C24H37NO7/c1-6-22(4)13-17(32-21(30)25-20(29)31-12-11-26)23(5)14(2)7-9-24(15(3)19(22)28)10-8-16(27)18(23)24/h6,14-15,17-19,26,28H,1,7-13H2,2-5H3,(H,25,29,30)/t14?,15-,17+,18-,19-,22+,23+,24-/m0/s1 |
| InChIKey | LFVIIVHVKLFOHT-SIBMJOIOSA-N |
| XLogP | 3.20 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|