C20H23FO4 — CID 102259531
diethyl 6-fluoro-7-methyl-1-phenylbicyclo[3.2.0]hept-6-ene-3,3-dicarboxylate (PubChem CID 102259531) has the molecular formula C20H23FO4 and a molecular weight of 346.40 g/mol. Its IUPAC name is diethyl 6-fluoro-7-methyl-1-phenylbicyclo[3.2.0]hept-6-ene-3,3-dicarboxylate.
| Compound Name | diethyl 6-fluoro-7-methyl-1-phenylbicyclo[3.2.0]hept-6-ene-3,3-dicarboxylate |
|---|---|
| PubChem CID | 102259531 |
| Molecular Formula | C20H23FO4 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | diethyl 6-fluoro-7-methyl-1-phenylbicyclo[3.2.0]hept-6-ene-3,3-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC2C(F)=C(C)C2(c2ccccc2)C1 |
| InChI | InChI=1S/C20H23FO4/c1-4-24-17(22)19(18(23)25-5-2)11-15-16(21)13(3)20(15,12-19)14-9-7-6-8-10-14/h6-10,15H,4-5,11-12H2,1-3H3 |
| InChIKey | FPKZNFUPQKEMDO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|