C15H29NO — CID 102259870
(2R,4S,6S)-2-tert-butyl-6-cyclohexylpiperidin-4-ol (PubChem CID 102259870) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is (2R,4S,6S)-2-tert-butyl-6-cyclohexylpiperidin-4-ol.
| Compound Name | (2R,4S,6S)-2-tert-butyl-6-cyclohexylpiperidin-4-ol |
|---|---|
| PubChem CID | 102259870 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | (2R,4S,6S)-2-tert-butyl-6-cyclohexylpiperidin-4-ol |
| SMILES | CC(C)(C)[C@H]1C[C@@H](O)C[C@@H](C2CCCCC2)N1 |
| InChI | InChI=1S/C15H29NO/c1-15(2,3)14-10-12(17)9-13(16-14)11-7-5-4-6-8-11/h11-14,16-17H,4-10H2,1-3H3/t12-,13-,14+/m0/s1 |
| InChIKey | HATVWNULNXTYPD-MELADBBJSA-N |
| XLogP | 3.09 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |