C13H23NO — CID 102259879
(2S,4R,6R)-2-cyclohexyl-6-ethenylpiperidin-4-ol (PubChem CID 102259879) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is (2S,4R,6R)-2-cyclohexyl-6-ethenylpiperidin-4-ol.
| Compound Name | (2S,4R,6R)-2-cyclohexyl-6-ethenylpiperidin-4-ol |
|---|---|
| PubChem CID | 102259879 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (2S,4R,6R)-2-cyclohexyl-6-ethenylpiperidin-4-ol |
| SMILES | C=C[C@H]1C[C@@H](O)C[C@@H](C2CCCCC2)N1 |
| InChI | InChI=1S/C13H23NO/c1-2-11-8-12(15)9-13(14-11)10-6-4-3-5-7-10/h2,10-15H,1,3-9H2/t11-,12+,13-/m0/s1 |
| InChIKey | BMXGSJXJVSVGST-XQQFMLRXSA-N |
| XLogP | 2.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|