C22H32O5 — CID 102260088
ethyl (2E)-2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-7-(4-methoxyphenyl)heptanoate (PubChem CID 102260088) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is ethyl (2E)-2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-7-(4-methoxyphenyl)heptanoate.
| Compound Name | ethyl (2E)-2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-7-(4-methoxyphenyl)heptanoate |
|---|---|
| PubChem CID | 102260088 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | ethyl (2E)-2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-7-(4-methoxyphenyl)heptanoate |
| SMILES | CCOC(=O)/C(=C/[C@@H]1COC(C)(C)O1)CCCCCc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H32O5/c1-5-25-21(23)18(15-20-16-26-22(2,3)27-20)10-8-6-7-9-17-11-13-19(24-4)14-12-17/h11-15,20H,5-10,16H2,1-4H3/b18-15+/t20-/m1/s1 |
| InChIKey | SDBVZAJMRWRINF-PHKMIBKXSA-N |
| XLogP | 4.44 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|