C16H20O6 — CID 102260380
2-[(2S,4E)-4-[(5S)-5-methyl-5-[(2S)-2-methylbutyl]furan-2-ylidene]-3,5-dioxooxolan-2-yl]acetic acid (PubChem CID 102260380) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is 2-[(2S,4E)-4-[(5S)-5-methyl-5-[(2S)-2-methylbutyl]furan-2-ylidene]-3,5-dioxooxolan-2-yl]acetic acid.
| Compound Name | 2-[(2S,4E)-4-[(5S)-5-methyl-5-[(2S)-2-methylbutyl]furan-2-ylidene]-3,5-dioxooxolan-2-yl]acetic acid |
|---|---|
| PubChem CID | 102260380 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-[(2S,4E)-4-[(5S)-5-methyl-5-[(2S)-2-methylbutyl]furan-2-ylidene]-3,5-dioxooxolan-2-yl]acetic acid |
| SMILES | CC[C@H](C)C[C@@]1(C)C=C/C(=C2\C(=O)O[C@@H](CC(=O)O)C2=O)O1 |
| InChI | InChI=1S/C16H20O6/c1-4-9(2)8-16(3)6-5-10(22-16)13-14(19)11(7-12(17)18)21-15(13)20/h5-6,9,11H,4,7-8H2,1-3H3,(H,17,18)/b13-10+/t9-,11-,16+/m0/s1 |
| InChIKey | PJLKMFDHUJBABS-QGSPPCKGSA-N |
| XLogP | 1.99 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|