C24H35NO8 — CID 102260526
5-O-tert-butyl 6-O-prop-2-enyl (2R,3aR,6R,6aS)-6-[(R)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-2-methoxy-6a-methyl-4-oxo-3,3a-dihydro-2H-furo[2,3-c]pyrrole-5,6-dicarboxylate (PubChem CID 102260526) has the molecular formula C24H35NO8 and a molecular weight of 465.54 g/mol. Its IUPAC name is 5-O-tert-butyl 6-O-prop-2-enyl (2R,3aR,6R,6aS)-6-[(R)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-2-methoxy-6a-methyl-4-oxo-3,3a-dihydro-2H-furo[2,3-c]pyrrole-5,6-dicarboxylate.
| Compound Name | 5-O-tert-butyl 6-O-prop-2-enyl (2R,3aR,6R,6aS)-6-[(R)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-2-methoxy-6a-methyl-4-oxo-3,3a-dihydro-2H-furo[2,3-c]pyrrole-5,6-dicarboxylate |
|---|---|
| PubChem CID | 102260526 |
| Molecular Formula | C24H35NO8 |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 5-O-tert-butyl 6-O-prop-2-enyl (2R,3aR,6R,6aS)-6-[(R)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-2-methoxy-6a-methyl-4-oxo-3,3a-dihydro-2H-furo[2,3-c]pyrrole-5,6-dicarboxylate |
| SMILES | C=CCOC(=O)[C@]1([C@H](O)[C@@H]2C=CCCC2)N(C(=O)OC(C)(C)C)C(=O)[C@@H]2C[C@H](OC)O[C@@]21C |
| InChI | InChI=1S/C24H35NO8/c1-7-13-31-20(28)24(18(26)15-11-9-8-10-12-15)23(5)16(14-17(30-6)32-23)19(27)25(24)21(29)33-22(2,3)4/h7,9,11,15-18,26H,1,8,10,12-14H2,2-6H3/t15-,16+,17-,18-,23+,24+/m1/s1 |
| InChIKey | JDRRXCUUPVGVDR-MVFCUBCPSA-N |
| XLogP | 2.72 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|