C19H31NO7 — CID 102260539
4-O-tert-butyl 1-O-ethyl (3R,4R,5R)-5-nitro-3-pentan-3-yloxycyclohexene-1,4-dicarboxylate (PubChem CID 102260539) has the molecular formula C19H31NO7 and a molecular weight of 385.46 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-ethyl (3R,4R,5R)-5-nitro-3-pentan-3-yloxycyclohexene-1,4-dicarboxylate.
| Compound Name | 4-O-tert-butyl 1-O-ethyl (3R,4R,5R)-5-nitro-3-pentan-3-yloxycyclohexene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 102260539 |
| Molecular Formula | C19H31NO7 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 4-O-tert-butyl 1-O-ethyl (3R,4R,5R)-5-nitro-3-pentan-3-yloxycyclohexene-1,4-dicarboxylate |
| SMILES | CCOC(=O)C1=C[C@@H](OC(CC)CC)[C@H](C(=O)OC(C)(C)C)[C@H]([N+](=O)[O-])C1 |
| InChI | InChI=1S/C19H31NO7/c1-7-13(8-2)26-15-11-12(17(21)25-9-3)10-14(20(23)24)16(15)18(22)27-19(4,5)6/h11,13-16H,7-10H2,1-6H3/t14-,15-,16-/m1/s1 |
| InChIKey | YFYSAZVMLGLYDT-BZUAXINKSA-N |
| XLogP | 3.06 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|