C10H16F3O3P — CID 102260717
2-diethoxyphosphoryl-1,1,1-trifluoro-4-methylpenta-2,3-diene (PubChem CID 102260717) has the molecular formula C10H16F3O3P and a molecular weight of 272.20 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-1,1,1-trifluoro-4-methylpenta-2,3-diene.
| Compound Name | 2-diethoxyphosphoryl-1,1,1-trifluoro-4-methylpenta-2,3-diene |
|---|---|
| PubChem CID | 102260717 |
| Molecular Formula | C10H16F3O3P |
| Molecular Weight | 272.20 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2-diethoxyphosphoryl-1,1,1-trifluoro-4-methylpenta-2,3-diene |
| SMILES | CCOP(=O)(OCC)C(=C=C(C)C)C(F)(F)F |
| InChI | InChI=1S/C10H16F3O3P/c1-5-15-17(14,16-6-2)9(7-8(3)4)10(11,12)13/h5-6H2,1-4H3 |
| InChIKey | OEYRIUDPMCMWGY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.20 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|