C29H17BF15NOS — CID 102260847
2-[2-(2,6-dimethylpyridin-1-ium-1-yl)ethylsulfanyl]ethoxy-tris(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 102260847) has the molecular formula C29H17BF15NOS and a molecular weight of 723.31 g/mol. Its IUPAC name is 2-[2-(2,6-dimethylpyridin-1-ium-1-yl)ethylsulfanyl]ethoxy-tris(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 2-[2-(2,6-dimethylpyridin-1-ium-1-yl)ethylsulfanyl]ethoxy-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 102260847 |
| Molecular Formula | C29H17BF15NOS |
| Molecular Weight | 723.31 g/mol |
| Exact Mass | 723.09 |
| IUPAC Name | 2-[2-(2,6-dimethylpyridin-1-ium-1-yl)ethylsulfanyl]ethoxy-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Cc1cccc(C)[n+]1CCSCCO[B-](c1c(F)c(F)c(F)c(F)c1F)(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C29H17BF15NOS/c1-10-4-3-5-11(2)46(10)6-8-48-9-7-47-30(12-15(31)21(37)27(43)22(38)16(12)32,13-17(33)23(39)28(44)24(40)18(13)34)14-19(35)25(41)29(45)26(42)20(14)36/h3-5H,6-9H2,1-2H3 |
| InChIKey | GSJNLFZBWBAMIW-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.31 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|