About [2,2-difluoro-1-(4-methylphenyl)ethenyl] 4-methylbenzenesulfonate
[2,2-difluoro-1-(4-methylphenyl)ethenyl] 4-methylbenzenesulfonate (PubChem CID 102261048) has the molecular formula C16H14F2O3S
and a molecular weight of 324.35 g/mol. Its IUPAC name is [2,2-difluoro-1-(4-methylphenyl)ethenyl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [2,2-difluoro-1-(4-methylphenyl)ethenyl] 4-methylbenzenesulfonate |
| PubChem CID | 102261048 |
| Molecular Formula | C16H14F2O3S |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | [2,2-difluoro-1-(4-methylphenyl)ethenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(C(OS(=O)(=O)c2ccc(C)cc2)=C(F)F)cc1 |
| InChI | InChI=1S/C16H14F2O3S/c1-11-3-7-13(8-4-11)15(16(17)18)21-22(19,20)14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
| InChIKey | VBJBVNROAUSAQW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2,2-difluoro-1-(4-methylphenyl)ethenyl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-difluoro-1-(4-methylphenyl)ethenyl] 4-methylbenzenesulfonate?
The IUPAC name of [2,2-difluoro-1-(4-methylphenyl)ethenyl] 4-methylbenzenesulfonate (CID 102261048) is [2,2-difluoro-1-(4-methylphenyl)ethenyl] 4-methylbenzenesulfonate.
What is the SMILES notation for [2,2-difluoro-1-(4-methylphenyl)ethenyl] 4-methylbenzenesulfonate?
The canonical SMILES for [2,2-difluoro-1-(4-methylphenyl)ethenyl] 4-methylbenzenesulfonate is Cc1ccc(C(OS(=O)(=O)c2ccc(C)cc2)=C(F)F)cc1.
What is the InChIKey of [2,2-difluoro-1-(4-methylphenyl)ethenyl] 4-methylbenzenesulfonate?
The InChIKey is VBJBVNROAUSAQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14F2O3S/c1-11-3-7-13(8-4-11)15(16(17)18)21-22(19,20)14-9-5-12(2)6-10-14/h3-10H,1-2H3.
What are the key properties of [2,2-difluoro-1-(4-methylphenyl)ethenyl] 4-methylbenzenesulfonate?
[2,2-difluoro-1-(4-methylphenyl)ethenyl] 4-methylbenzenesulfonate has a molecular weight of 324.35 g/mol, XLogP of 4.27, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-difluoro-1-(4-methylphenyl)ethenyl] 4-methylbenzenesulfonate is sourced from PubChem (CID 102261048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).