C16H14F2O4S — CID 102261050
[2,2-difluoro-1-(3-methoxyphenyl)ethenyl] 4-methylbenzenesulfonate (PubChem CID 102261050) has the molecular formula C16H14F2O4S and a molecular weight of 340.35 g/mol. Its IUPAC name is [2,2-difluoro-1-(3-methoxyphenyl)ethenyl] 4-methylbenzenesulfonate.
| Compound Name | [2,2-difluoro-1-(3-methoxyphenyl)ethenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 102261050 |
| Molecular Formula | C16H14F2O4S |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | [2,2-difluoro-1-(3-methoxyphenyl)ethenyl] 4-methylbenzenesulfonate |
| SMILES | COc1cccc(C(OS(=O)(=O)c2ccc(C)cc2)=C(F)F)c1 |
| InChI | InChI=1S/C16H14F2O4S/c1-11-6-8-14(9-7-11)23(19,20)22-15(16(17)18)12-4-3-5-13(10-12)21-2/h3-10H,1-2H3 |
| InChIKey | UVQMLDBJTNMJEZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|