About triethyl-[(1R,2R)-4-iodo-3-phenyl-2-prop-1-en-2-ylcyclopent-3-en-1-yl]oxysilane
triethyl-[(1R,2R)-4-iodo-3-phenyl-2-prop-1-en-2-ylcyclopent-3-en-1-yl]oxysilane (PubChem CID 102261140) has the molecular formula C20H29IOSi
and a molecular weight of 440.44 g/mol. Its IUPAC name is triethyl-[(1R,2R)-4-iodo-3-phenyl-2-prop-1-en-2-ylcyclopent-3-en-1-yl]oxysilane.
Molecular Properties
| Compound Name | triethyl-[(1R,2R)-4-iodo-3-phenyl-2-prop-1-en-2-ylcyclopent-3-en-1-yl]oxysilane |
| PubChem CID | 102261140 |
| Molecular Formula | C20H29IOSi |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | triethyl-[(1R,2R)-4-iodo-3-phenyl-2-prop-1-en-2-ylcyclopent-3-en-1-yl]oxysilane |
| SMILES | C=C(C)[C@@H]1C(c2ccccc2)=C(I)C[C@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C20H29IOSi/c1-6-23(7-2,8-3)22-18-14-17(21)20(19(18)15(4)5)16-12-10-9-11-13-16/h9-13,18-19H,4,6-8,14H2,1-3,5H3/t18-,19+/m1/s1 |
| InChIKey | CBSNPJZLTDNYML-MOPGFXCFSA-N |
| XLogP | 6.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze triethyl-[(1R,2R)-4-iodo-3-phenyl-2-prop-1-en-2-ylcyclopent-3-en-1-yl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-[(1R,2R)-4-iodo-3-phenyl-2-prop-1-en-2-ylcyclopent-3-en-1-yl]oxysilane?
The IUPAC name of triethyl-[(1R,2R)-4-iodo-3-phenyl-2-prop-1-en-2-ylcyclopent-3-en-1-yl]oxysilane (CID 102261140) is triethyl-[(1R,2R)-4-iodo-3-phenyl-2-prop-1-en-2-ylcyclopent-3-en-1-yl]oxysilane.
What is the SMILES notation for triethyl-[(1R,2R)-4-iodo-3-phenyl-2-prop-1-en-2-ylcyclopent-3-en-1-yl]oxysilane?
The canonical SMILES for triethyl-[(1R,2R)-4-iodo-3-phenyl-2-prop-1-en-2-ylcyclopent-3-en-1-yl]oxysilane is C=C(C)[C@@H]1C(c2ccccc2)=C(I)C[C@H]1O[Si](CC)(CC)CC.
What is the InChIKey of triethyl-[(1R,2R)-4-iodo-3-phenyl-2-prop-1-en-2-ylcyclopent-3-en-1-yl]oxysilane?
The InChIKey is CBSNPJZLTDNYML-MOPGFXCFSA-N. The full InChI is InChI=1S/C20H29IOSi/c1-6-23(7-2,8-3)22-18-14-17(21)20(19(18)15(4)5)16-12-10-9-11-13-16/h9-13,18-19H,4,6-8,14H2,1-3,5H3/t18-,19+/m1/s1.
What are the key properties of triethyl-[(1R,2R)-4-iodo-3-phenyl-2-prop-1-en-2-ylcyclopent-3-en-1-yl]oxysilane?
triethyl-[(1R,2R)-4-iodo-3-phenyl-2-prop-1-en-2-ylcyclopent-3-en-1-yl]oxysilane has a molecular weight of 440.44 g/mol, XLogP of 6.82, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-[(1R,2R)-4-iodo-3-phenyl-2-prop-1-en-2-ylcyclopent-3-en-1-yl]oxysilane is sourced from PubChem (CID 102261140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).