About [(1S)-1-pyridin-2-ylethyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate
[(1S)-1-pyridin-2-ylethyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 102262019) has the molecular formula C17H16F3NO3
and a molecular weight of 339.31 g/mol. Its IUPAC name is [(1S)-1-pyridin-2-ylethyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
Molecular Properties
| Compound Name | [(1S)-1-pyridin-2-ylethyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| PubChem CID | 102262019 |
| Molecular Formula | C17H16F3NO3 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | [(1S)-1-pyridin-2-ylethyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CO[C@](C(=O)O[C@@H](C)c1ccccn1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H16F3NO3/c1-12(14-10-6-7-11-21-14)24-15(22)16(23-2,17(18,19)20)13-8-4-3-5-9-13/h3-12H,1-2H3/t12-,16-/m0/s1 |
| InChIKey | RCRLBPZSVYEAHF-LRDDRELGSA-N |
| XLogP | 3.79 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1S)-1-pyridin-2-ylethyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-pyridin-2-ylethyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate?
The IUPAC name of [(1S)-1-pyridin-2-ylethyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (CID 102262019) is [(1S)-1-pyridin-2-ylethyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
What is the SMILES notation for [(1S)-1-pyridin-2-ylethyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate?
The canonical SMILES for [(1S)-1-pyridin-2-ylethyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate is CO[C@](C(=O)O[C@@H](C)c1ccccn1)(c1ccccc1)C(F)(F)F.
What is the InChIKey of [(1S)-1-pyridin-2-ylethyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate?
The InChIKey is RCRLBPZSVYEAHF-LRDDRELGSA-N. The full InChI is InChI=1S/C17H16F3NO3/c1-12(14-10-6-7-11-21-14)24-15(22)16(23-2,17(18,19)20)13-8-4-3-5-9-13/h3-12H,1-2H3/t12-,16-/m0/s1.
What are the key properties of [(1S)-1-pyridin-2-ylethyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate?
[(1S)-1-pyridin-2-ylethyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate has a molecular weight of 339.31 g/mol, XLogP of 3.79, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-pyridin-2-ylethyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate is sourced from PubChem (CID 102262019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).