C14H18O5 — CID 102262708
dimethyl (3aR,4R,7aS)-4-formyl-1,3,3a,4,5,7a-hexahydroindene-2,2-dicarboxylate (PubChem CID 102262708) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is dimethyl (3aR,4R,7aS)-4-formyl-1,3,3a,4,5,7a-hexahydroindene-2,2-dicarboxylate.
| Compound Name | dimethyl (3aR,4R,7aS)-4-formyl-1,3,3a,4,5,7a-hexahydroindene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102262708 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | dimethyl (3aR,4R,7aS)-4-formyl-1,3,3a,4,5,7a-hexahydroindene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H]2[C@H](C=O)CC=C[C@@H]2C1 |
| InChI | InChI=1S/C14H18O5/c1-18-12(16)14(13(17)19-2)6-9-4-3-5-10(8-15)11(9)7-14/h3-4,8-11H,5-7H2,1-2H3/t9-,10+,11-/m1/s1 |
| InChIKey | SUXDTVLBLZDAJT-OUAUKWLOSA-N |
| XLogP | 1.12 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|