C12H13F3OS2 — CID 102263066
(2S)-2-[(1S)-2,2,2-trifluoro-1-phenylethyl]-1,3-dithiane 1-oxide (PubChem CID 102263066) has the molecular formula C12H13F3OS2 and a molecular weight of 294.36 g/mol. Its IUPAC name is (2S)-2-[(1S)-2,2,2-trifluoro-1-phenylethyl]-1,3-dithiane 1-oxide.
| Compound Name | (2S)-2-[(1S)-2,2,2-trifluoro-1-phenylethyl]-1,3-dithiane 1-oxide |
|---|---|
| PubChem CID | 102263066 |
| Molecular Formula | C12H13F3OS2 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | (2S)-2-[(1S)-2,2,2-trifluoro-1-phenylethyl]-1,3-dithiane 1-oxide |
| SMILES | O=S1CCCS[C@@H]1[C@@H](c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H13F3OS2/c13-12(14,15)10(9-5-2-1-3-6-9)11-17-7-4-8-18(11)16/h1-3,5-6,10-11H,4,7-8H2/t10-,11+,18?/m1/s1 |
| InChIKey | BQWUXSXMHRRANN-UNRMPFGOSA-N |
| XLogP | 3.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |