C14H23F3O3S2 — CID 102263067
ethyl (7S)-8,8,8-trifluoro-7-[(2S)-1-oxo-1,3-dithian-2-yl]octanoate (PubChem CID 102263067) has the molecular formula C14H23F3O3S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is ethyl (7S)-8,8,8-trifluoro-7-[(2S)-1-oxo-1,3-dithian-2-yl]octanoate.
| Compound Name | ethyl (7S)-8,8,8-trifluoro-7-[(2S)-1-oxo-1,3-dithian-2-yl]octanoate |
|---|---|
| PubChem CID | 102263067 |
| Molecular Formula | C14H23F3O3S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | ethyl (7S)-8,8,8-trifluoro-7-[(2S)-1-oxo-1,3-dithian-2-yl]octanoate |
| SMILES | CCOC(=O)CCCCC[C@H]([C@H]1SCCCS1=O)C(F)(F)F |
| InChI | InChI=1S/C14H23F3O3S2/c1-2-20-12(18)8-5-3-4-7-11(14(15,16)17)13-21-9-6-10-22(13)19/h11,13H,2-10H2,1H3/t11-,13+,22?/m1/s1 |
| InChIKey | OVTBQTBCDDKEOF-YZQUQHLXSA-N |
| XLogP | 3.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|