C13H18N2O3S — CID 102263226
7-ethoxy-2-sulfanylidenespiro[6,7-dihydro-1H-pyrano[2,3-d]pyrimidine-5,1'-cyclopentane]-4-one (PubChem CID 102263226) has the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. Its IUPAC name is 7-ethoxy-2-sulfanylidenespiro[6,7-dihydro-1H-pyrano[2,3-d]pyrimidine-5,1'-cyclopentane]-4-one.
| Compound Name | 7-ethoxy-2-sulfanylidenespiro[6,7-dihydro-1H-pyrano[2,3-d]pyrimidine-5,1'-cyclopentane]-4-one |
|---|---|
| PubChem CID | 102263226 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 7-ethoxy-2-sulfanylidenespiro[6,7-dihydro-1H-pyrano[2,3-d]pyrimidine-5,1'-cyclopentane]-4-one |
| SMILES | CCOC1CC2(CCCC2)c2c([nH]c(=S)[nH]c2=O)O1 |
| InChI | InChI=1S/C13H18N2O3S/c1-2-17-8-7-13(5-3-4-6-13)9-10(16)14-12(19)15-11(9)18-8/h8H,2-7H2,1H3,(H2,14,15,16,19) |
| InChIKey | FMXAOLWULWLIFL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 67.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|