C22H24ClN5O4 — CID 10226332
8-[(1-chloro-6,7-dimethoxyisoquinolin-4-yl)methyl]-1-methyl-3-(2-methylpropyl)-7H-purine-2,6-dione (PubChem CID 10226332) has the molecular formula C22H24ClN5O4 and a molecular weight of 457.92 g/mol. Its IUPAC name is 8-[(1-chloro-6,7-dimethoxyisoquinolin-4-yl)methyl]-1-methyl-3-(2-methylpropyl)-7H-purine-2,6-dione.
| Compound Name | 8-[(1-chloro-6,7-dimethoxyisoquinolin-4-yl)methyl]-1-methyl-3-(2-methylpropyl)-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 10226332 |
| Molecular Formula | C22H24ClN5O4 |
| Molecular Weight | 457.92 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 8-[(1-chloro-6,7-dimethoxyisoquinolin-4-yl)methyl]-1-methyl-3-(2-methylpropyl)-7H-purine-2,6-dione |
| SMILES | COc1cc2c(Cc3nc4c([nH]3)c(=O)n(C)c(=O)n4CC(C)C)cnc(Cl)c2cc1OC |
| InChI | InChI=1S/C22H24ClN5O4/c1-11(2)10-28-20-18(21(29)27(3)22(28)30)25-17(26-20)6-12-9-24-19(23)14-8-16(32-5)15(31-4)7-13(12)14/h7-9,11H,6,10H2,1-5H3,(H,25,26) |
| InChIKey | OPNCMSBLGKDVMX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.92 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|