C11H6O4S6-2 — CID 102263686
2-(6,7-dihydro-5H-[1,3]dithiolo[4,5-b][1,4]dithiepin-2-ylidene)-1,3-dithiole-4,5-dicarboxylate (PubChem CID 102263686) has the molecular formula C11H6O4S6-2 and a molecular weight of 394.57 g/mol. Its IUPAC name is 2-(6,7-dihydro-5H-[1,3]dithiolo[4,5-b][1,4]dithiepin-2-ylidene)-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | 2-(6,7-dihydro-5H-[1,3]dithiolo[4,5-b][1,4]dithiepin-2-ylidene)-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 102263686 |
| Molecular Formula | C11H6O4S6-2 |
| Molecular Weight | 394.57 g/mol |
| Exact Mass | 393.86 |
| IUPAC Name | 2-(6,7-dihydro-5H-[1,3]dithiolo[4,5-b][1,4]dithiepin-2-ylidene)-1,3-dithiole-4,5-dicarboxylate |
| SMILES | O=C([O-])C1=C(C(=O)[O-])SC(=C2SC3=C(SCCCS3)S2)S1 |
| InChI | InChI=1S/C11H8O4S6/c12-6(13)4-5(7(14)15)19-10(18-4)11-20-8-9(21-11)17-3-1-2-16-8/h1-3H2,(H,12,13)(H,14,15)/p-2 |
| InChIKey | URLRKXLQOLBISU-UHFFFAOYSA-L |
| XLogP | 1.78 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.57 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |