C20H24N2O6S — CID 102263876
(3aR,5S,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3'-phenyl-2'-sulfanylidenespiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,5'-imidazolidine]-4'-one (PubChem CID 102263876) has the molecular formula C20H24N2O6S and a molecular weight of 420.49 g/mol. Its IUPAC name is (3aR,5S,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3'-phenyl-2'-sulfanylidenespiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,5'-imidazolidine]-4'-one.
| Compound Name | (3aR,5S,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3'-phenyl-2'-sulfanylidenespiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,5'-imidazolidine]-4'-one |
|---|---|
| PubChem CID | 102263876 |
| Molecular Formula | C20H24N2O6S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | (3aR,5S,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3'-phenyl-2'-sulfanylidenespiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,5'-imidazolidine]-4'-one |
| SMILES | CC1(C)OC[C@H]([C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@]23NC(=S)N(c2ccccc2)C3=O)O1 |
| InChI | InChI=1S/C20H24N2O6S/c1-18(2)24-10-12(26-18)13-20(14-15(25-13)28-19(3,4)27-14)16(23)22(17(29)21-20)11-8-6-5-7-9-11/h5-9,12-15H,10H2,1-4H3,(H,21,29)/t12-,13-,14+,15-,20-/m1/s1 |
| InChIKey | XDDZCDHYEAMRIJ-MKOKDDGESA-N |
| XLogP | 1.67 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|