C62H71NO3S3 — CID 102264010
10-[4-[5-[9,9-dihexyl-6-[5-(5-pyridin-4-ylthiophen-2-yl)thiophen-2-yl]fluoren-2-yl]thiophen-2-yl]phenoxy]decyl 2-methylprop-2-enoate (PubChem CID 102264010) has the molecular formula C62H71NO3S3 and a molecular weight of 974.45 g/mol. Its IUPAC name is 10-[4-[5-[9,9-dihexyl-6-[5-(5-pyridin-4-ylthiophen-2-yl)thiophen-2-yl]fluoren-2-yl]thiophen-2-yl]phenoxy]decyl 2-methylprop-2-enoate.
| Compound Name | 10-[4-[5-[9,9-dihexyl-6-[5-(5-pyridin-4-ylthiophen-2-yl)thiophen-2-yl]fluoren-2-yl]thiophen-2-yl]phenoxy]decyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102264010 |
| Molecular Formula | C62H71NO3S3 |
| Molecular Weight | 974.45 g/mol |
| Exact Mass | 973.46 |
| IUPAC Name | 10-[4-[5-[9,9-dihexyl-6-[5-(5-pyridin-4-ylthiophen-2-yl)thiophen-2-yl]fluoren-2-yl]thiophen-2-yl]phenoxy]decyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCCCCOc1ccc(-c2ccc(-c3ccc4c(c3)C(CCCCCC)(CCCCCC)c3ccc(-c5ccc(-c6ccc(-c7ccncc7)s6)s5)cc3-4)s2)cc1 |
| InChI | InChI=1S/C62H71NO3S3/c1-5-7-9-17-37-62(38-18-10-8-6-2)53-28-24-48(57-32-34-60(69-57)59-33-31-56(68-59)47-35-39-63-40-36-47)43-52(53)51-27-23-49(44-54(51)62)58-30-29-55(67-58)46-21-25-50(26-22-46)65-41-19-15-13-11-12-14-16-20-42-66-61(64)45(3)4/h21-36,39-40,43-44H,3,5-20,37-38,41-42H2,1-2,4H3 |
| InChIKey | MZGHFKYPAYHAAJ-UHFFFAOYSA-N |
| XLogP | 19.43 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 974.45 |
| LogP ≤ 5 | 19.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|