C13H18O4 — CID 102264123
ethyl (4aS,7R,8R,8aR)-7-methyl-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxylate (PubChem CID 102264123) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is ethyl (4aS,7R,8R,8aR)-7-methyl-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxylate.
| Compound Name | ethyl (4aS,7R,8R,8aR)-7-methyl-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxylate |
|---|---|
| PubChem CID | 102264123 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | ethyl (4aS,7R,8R,8aR)-7-methyl-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]2C(=O)OCC[C@H]2C=C[C@H]1C |
| InChI | InChI=1S/C13H18O4/c1-3-16-12(14)10-8(2)4-5-9-6-7-17-13(15)11(9)10/h4-5,8-11H,3,6-7H2,1-2H3/t8-,9-,10-,11-/m1/s1 |
| InChIKey | VSOZQBCRTPEXHA-GWOFURMSSA-N |
| XLogP | 1.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|