C24H20Cl4O8 — CID 102264152
(1R,2R,3R,4R,7S,8R,15R,16S)-1,4,7,16-tetrachloro-19,19,20,20-tetramethoxyhexacyclo[14.2.1.14,7.02,15.03,8.09,14]icosa-9,11,13-triene-5,6,17,18-tetrone (PubChem CID 102264152) has the molecular formula C24H20Cl4O8 and a molecular weight of 578.23 g/mol. Its IUPAC name is (1R,2R,3R,4R,7S,8R,15R,16S)-1,4,7,16-tetrachloro-19,19,20,20-tetramethoxyhexacyclo[14.2.1.14,7.02,15.03,8.09,14]icosa-9,11,13-triene-5,6,17,18-tetrone.
| Compound Name | (1R,2R,3R,4R,7S,8R,15R,16S)-1,4,7,16-tetrachloro-19,19,20,20-tetramethoxyhexacyclo[14.2.1.14,7.02,15.03,8.09,14]icosa-9,11,13-triene-5,6,17,18-tetrone |
|---|---|
| PubChem CID | 102264152 |
| Molecular Formula | C24H20Cl4O8 |
| Molecular Weight | 578.23 g/mol |
| Exact Mass | 575.99 |
| IUPAC Name | (1R,2R,3R,4R,7S,8R,15R,16S)-1,4,7,16-tetrachloro-19,19,20,20-tetramethoxyhexacyclo[14.2.1.14,7.02,15.03,8.09,14]icosa-9,11,13-triene-5,6,17,18-tetrone |
| SMILES | COC1(OC)[C@@]2(Cl)C(=O)C(=O)[C@]1(Cl)[C@@H]1[C@@H]3[C@H](c4ccccc4[C@@H]12)[C@]1(Cl)C(=O)C(=O)[C@@]3(Cl)C1(OC)OC |
| InChI | InChI=1S/C24H20Cl4O8/c1-33-23(34-2)19(25)11-9-7-5-6-8-10(9)12-14(13(11)21(23,27)17(31)15(19)29)22(28)18(32)16(30)20(12,26)24(22,35-3)36-4/h5-8,11-14H,1-4H3/t11-,12-,13-,14-,19-,20-,21+,22+/m0/s1 |
| InChIKey | IHXHKWXSARUAPE-IWGCJKJQSA-N |
| XLogP | 2.32 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.23 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|