C31H26O7 — CID 102264197
[(2R,3S,3aS,6aR)-5-oxo-2-[(R)-phenyl-[(E)-3-phenylprop-2-enoyl]oxymethyl]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] (E)-3-phenylprop-2-enoate (PubChem CID 102264197) has the molecular formula C31H26O7 and a molecular weight of 510.54 g/mol. Its IUPAC name is [(2R,3S,3aS,6aR)-5-oxo-2-[(R)-phenyl-[(E)-3-phenylprop-2-enoyl]oxymethyl]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(2R,3S,3aS,6aR)-5-oxo-2-[(R)-phenyl-[(E)-3-phenylprop-2-enoyl]oxymethyl]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 102264197 |
| Molecular Formula | C31H26O7 |
| Molecular Weight | 510.54 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | [(2R,3S,3aS,6aR)-5-oxo-2-[(R)-phenyl-[(E)-3-phenylprop-2-enoyl]oxymethyl]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1)O[C@@H]1[C@H]2OC(=O)C[C@H]2O[C@@H]1[C@H](OC(=O)/C=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H26O7/c32-25(18-16-21-10-4-1-5-11-21)36-28(23-14-8-3-9-15-23)30-31(29-24(35-30)20-27(34)38-29)37-26(33)19-17-22-12-6-2-7-13-22/h1-19,24,28-31H,20H2/b18-16+,19-17+/t24-,28-,29+,30-,31-/m1/s1 |
| InChIKey | DQJWUTFOIIPQBE-PCLLYBOASA-N |
| XLogP | 4.69 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|