About CID 102264304
CID 102264304 (PubChem CID 102264304) has the molecular formula C98H146P4
and a molecular weight of 1448.14 g/mol.
Molecular Properties
| Compound Name | CID 102264304 |
| PubChem CID | 102264304 |
| Molecular Formula | C98H146P4 |
| Molecular Weight | 1448.14 g/mol |
| Exact Mass | 1447.04 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(C2=P(Cc3ccc(-c4ccc(CP5=C(c6c(C(C)(C)C)cc(C(C)(C)C)cc6C(C)(C)C)P(C(C)(C)C)C=5c5c(C(C)(C)C)cc(C(C)(C)C)cc5C(C)(C)C)cc4)cc3)=C(c3c(C(C)(C)C)cc(C(C)(C)C)cc3C(C)(C)C)P2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C98H146P4/c1-85(2,3)65-51-69(89(13,14)15)77(70(52-65)90(16,17)18)81-99(82(101(81)97(37,38)39)78-71(91(19,20)21)53-66(86(4,5)6)54-72(78)92(22,23)24)59-61-43-47-63(48-44-61)64-49-45-62(46-50-64)60-100-83(79-73(93(25,26)27)55-67(87(7,8)9)56-74(79)94(28,29)30)102(98(40,41)42)84(100)80-75(95(31,32)33)57-68(88(10,11)12)58-76(80)96(34,35)36/h43-58H,59-60H2,1-42H3 |
| InChIKey | AESCSXZSAUFYFL-UHFFFAOYSA-N |
| XLogP | 30.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 102 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1448.14 |
| LogP ≤ 5 | 30.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 102264304 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102264304?
The IUPAC name of CID 102264304 (CID 102264304) is not available.
What is the SMILES notation for CID 102264304?
The canonical SMILES for CID 102264304 is CC(C)(C)c1cc(C(C)(C)C)c(C2=P(Cc3ccc(-c4ccc(CP5=C(c6c(C(C)(C)C)cc(C(C)(C)C)cc6C(C)(C)C)P(C(C)(C)C)C=5c5c(C(C)(C)C)cc(C(C)(C)C)cc5C(C)(C)C)cc4)cc3)=C(c3c(C(C)(C)C)cc(C(C)(C)C)cc3C(C)(C)C)P2C(C)(C)C)c(C(C)(C)C)c1.
What is the InChIKey of CID 102264304?
The InChIKey is AESCSXZSAUFYFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C98H146P4/c1-85(2,3)65-51-69(89(13,14)15)77(70(52-65)90(16,17)18)81-99(82(101(81)97(37,38)39)78-71(91(19,20)21)53-66(86(4,5)6)54-72(78)92(22,23)24)59-61-43-47-63(48-44-61)64-49-45-62(46-50-64)60-100-83(79-73(93(25,26)27)55-67(87(7,8)9)56-74(79)94(28,29)30)102(98(40,41)42)84(100)80-75(95(31,32)33)57-68(88(10,11)12)58-76(80)96(34,35)36/h43-58H,59-60H2,1-42H3.
What are the key properties of CID 102264304?
CID 102264304 has a molecular weight of 1448.14 g/mol, XLogP of 30.19, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102264304 is sourced from PubChem (CID 102264304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).