C23H27O8- — CID 102265343
2-methyl-5-[(1E,3E,5E)-7-(2-methyl-4,6-dioxo-2-propyl-1,3-dioxan-5-ylidene)hepta-1,3,5-trienyl]-6-oxo-2-propyl-1,3-dioxin-4-olate (PubChem CID 102265343) has the molecular formula C23H27O8- and a molecular weight of 431.46 g/mol. Its IUPAC name is 2-methyl-5-[(1E,3E,5E)-7-(2-methyl-4,6-dioxo-2-propyl-1,3-dioxan-5-ylidene)hepta-1,3,5-trienyl]-6-oxo-2-propyl-1,3-dioxin-4-olate.
| Compound Name | 2-methyl-5-[(1E,3E,5E)-7-(2-methyl-4,6-dioxo-2-propyl-1,3-dioxan-5-ylidene)hepta-1,3,5-trienyl]-6-oxo-2-propyl-1,3-dioxin-4-olate |
|---|---|
| PubChem CID | 102265343 |
| Molecular Formula | C23H27O8- |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 2-methyl-5-[(1E,3E,5E)-7-(2-methyl-4,6-dioxo-2-propyl-1,3-dioxan-5-ylidene)hepta-1,3,5-trienyl]-6-oxo-2-propyl-1,3-dioxin-4-olate |
| SMILES | CCCC1(C)OC(=O)C(=C/C=C/C=C/C=C/C2=C([O-])OC(C)(CCC)OC2=O)C(=O)O1 |
| InChI | InChI=1S/C23H28O8/c1-5-14-22(3)28-18(24)16(19(25)29-22)12-10-8-7-9-11-13-17-20(26)30-23(4,15-6-2)31-21(17)27/h7-13,24H,5-6,14-15H2,1-4H3/p-1/b8-7+,11-9+,12-10+,17-13- |
| InChIKey | ULIZOQIZCUFQQY-XZQFRQJGSA-M |
| XLogP | 2.86 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|