C48H52N6 — CID 102265799
2-[[4-(dibutylamino)phenyl]-[3-[3-[2,2-dicyano-1-[4-(dibutylamino)phenyl]ethenyl]phenyl]phenyl]methylidene]propanedinitrile (PubChem CID 102265799) has the molecular formula C48H52N6 and a molecular weight of 712.99 g/mol. Its IUPAC name is 2-[[4-(dibutylamino)phenyl]-[3-[3-[2,2-dicyano-1-[4-(dibutylamino)phenyl]ethenyl]phenyl]phenyl]methylidene]propanedinitrile.
| Compound Name | 2-[[4-(dibutylamino)phenyl]-[3-[3-[2,2-dicyano-1-[4-(dibutylamino)phenyl]ethenyl]phenyl]phenyl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 102265799 |
| Molecular Formula | C48H52N6 |
| Molecular Weight | 712.99 g/mol |
| Exact Mass | 712.43 |
| IUPAC Name | 2-[[4-(dibutylamino)phenyl]-[3-[3-[2,2-dicyano-1-[4-(dibutylamino)phenyl]ethenyl]phenyl]phenyl]methylidene]propanedinitrile |
| SMILES | CCCCN(CCCC)c1ccc(C(=C(C#N)C#N)c2cccc(-c3cccc(C(=C(C#N)C#N)c4ccc(N(CCCC)CCCC)cc4)c3)c2)cc1 |
| InChI | InChI=1S/C48H52N6/c1-5-9-27-53(28-10-6-2)45-23-19-37(20-24-45)47(43(33-49)34-50)41-17-13-15-39(31-41)40-16-14-18-42(32-40)48(44(35-51)36-52)38-21-25-46(26-22-38)54(29-11-7-3)30-12-8-4/h13-26,31-32H,5-12,27-30H2,1-4H3 |
| InChIKey | IWTZNEOVHLDKHK-UHFFFAOYSA-N |
| XLogP | 11.86 |
| TPSA | 101.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.99 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|