About ethyl (E)-3-(2,4-diphenylnaphthalen-1-yl)prop-2-enoate
ethyl (E)-3-(2,4-diphenylnaphthalen-1-yl)prop-2-enoate (PubChem CID 102265861) has the molecular formula C27H22O2
and a molecular weight of 378.47 g/mol. Its IUPAC name is ethyl (E)-3-(2,4-diphenylnaphthalen-1-yl)prop-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-3-(2,4-diphenylnaphthalen-1-yl)prop-2-enoate |
| PubChem CID | 102265861 |
| Molecular Formula | C27H22O2 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | ethyl (E)-3-(2,4-diphenylnaphthalen-1-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1c(-c2ccccc2)cc(-c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C27H22O2/c1-2-29-27(28)18-17-24-22-15-9-10-16-23(22)25(20-11-5-3-6-12-20)19-26(24)21-13-7-4-8-14-21/h3-19H,2H2,1H3/b18-17+ |
| InChIKey | CPRIMRQVPCNKSD-ISLYRVAYSA-N |
| XLogP | 6.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-3-(2,4-diphenylnaphthalen-1-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-3-(2,4-diphenylnaphthalen-1-yl)prop-2-enoate?
The IUPAC name of ethyl (E)-3-(2,4-diphenylnaphthalen-1-yl)prop-2-enoate (CID 102265861) is ethyl (E)-3-(2,4-diphenylnaphthalen-1-yl)prop-2-enoate.
What is the SMILES notation for ethyl (E)-3-(2,4-diphenylnaphthalen-1-yl)prop-2-enoate?
The canonical SMILES for ethyl (E)-3-(2,4-diphenylnaphthalen-1-yl)prop-2-enoate is CCOC(=O)/C=C/c1c(-c2ccccc2)cc(-c2ccccc2)c2ccccc12.
What is the InChIKey of ethyl (E)-3-(2,4-diphenylnaphthalen-1-yl)prop-2-enoate?
The InChIKey is CPRIMRQVPCNKSD-ISLYRVAYSA-N. The full InChI is InChI=1S/C27H22O2/c1-2-29-27(28)18-17-24-22-15-9-10-16-23(22)25(20-11-5-3-6-12-20)19-26(24)21-13-7-4-8-14-21/h3-19H,2H2,1H3/b18-17+.
What are the key properties of ethyl (E)-3-(2,4-diphenylnaphthalen-1-yl)prop-2-enoate?
ethyl (E)-3-(2,4-diphenylnaphthalen-1-yl)prop-2-enoate has a molecular weight of 378.47 g/mol, XLogP of 6.75, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-3-(2,4-diphenylnaphthalen-1-yl)prop-2-enoate is sourced from PubChem (CID 102265861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).