C27H29NO9 — CID 102265969
[(2R,3S)-6-(5-aminopentyl)-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate (PubChem CID 102265969) has the molecular formula C27H29NO9 and a molecular weight of 511.53 g/mol. Its IUPAC name is [(2R,3S)-6-(5-aminopentyl)-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate.
| Compound Name | [(2R,3S)-6-(5-aminopentyl)-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 102265969 |
| Molecular Formula | C27H29NO9 |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | [(2R,3S)-6-(5-aminopentyl)-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
| SMILES | NCCCCCc1ccc2c(c1)C[C@H](OC(=O)c1cc(O)c(O)c(O)c1)[C@@H](c1cc(O)c(O)c(O)c1)O2 |
| InChI | InChI=1S/C27H29NO9/c28-7-3-1-2-4-14-5-6-22-15(8-14)13-23(26(36-22)16-9-18(29)24(33)19(30)10-16)37-27(35)17-11-20(31)25(34)21(32)12-17/h5-6,8-12,23,26,29-34H,1-4,7,13,28H2/t23-,26+/m0/s1 |
| InChIKey | VCYKQLTZDYIHAA-JYFHCDHNSA-N |
| XLogP | 3.49 |
| TPSA | 182.93 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|